C19H26O4 — CID 145978659
(4aR,5S,6S,8aR)-5-[(E)-4-carboxy-3-methylbut-3-enyl]-6,8a-dimethyl-5,6,7,8-tetrahydro-4aH-naphthalene-1-carboxylic acid (PubChem CID 145978659) has the molecular formula C19H26O4 and a molecular weight of 318.40 g/mol. Its IUPAC name is (4aR,5S,6S,8aR)-5-[(E)-4-carboxy-3-methylbut-3-enyl]-6,8a-dimethyl-5,6,7,8-tetrahydro-4aH-naphthalene-1-carboxylic acid.
| Compound Name | (4aR,5S,6S,8aR)-5-[(E)-4-carboxy-3-methylbut-3-enyl]-6,8a-dimethyl-5,6,7,8-tetrahydro-4aH-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 145978659 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (4aR,5S,6S,8aR)-5-[(E)-4-carboxy-3-methylbut-3-enyl]-6,8a-dimethyl-5,6,7,8-tetrahydro-4aH-naphthalene-1-carboxylic acid |
| SMILES | C[C@H]1CC[C@@]2([C@@H]([C@H]1CC/C(=C/C(=O)O)/C)C=CC=C2C(=O)O)C |
| InChI | InChI=1S/C19H26O4/c1-12(11-17(20)21)7-8-14-13(2)9-10-19(3)15(14)5-4-6-16(19)18(22)23/h4-6,11,13-15H,7-10H2,1-3H3,(H,20,21)(H,22,23)/b12-11+/t13-,14-,15+,19+/m0/s1 |
| InChIKey | JPRBFLLJRHEFCK-QFLDUGJNSA-N |
| XLogP | 4.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | 584 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|