C8H16O3 — CID 14597942
2-(methoxymethyl)-5,5-dimethyl-1,3-dioxane (PubChem CID 14597942) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 2-(methoxymethyl)-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-(methoxymethyl)-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 14597942 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 2-(methoxymethyl)-5,5-dimethyl-1,3-dioxane |
| SMILES | COCC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C8H16O3/c1-8(2)5-10-7(4-9-3)11-6-8/h7H,4-6H2,1-3H3 |
| InChIKey | CSLAGYLNVXNEFD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |