C14H18O4 — CID 14598178
(2Z,4E)-5-(1-hydroxy-6,6-dimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 14598178) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (2Z,4E)-5-(1-hydroxy-6,6-dimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-(1-hydroxy-6,6-dimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 14598178 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2Z,4E)-5-(1-hydroxy-6,6-dimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(=C/C(=O)O)/C=C/C1(O)C=CC(=O)CC1(C)C |
| InChI | InChI=1S/C14H18O4/c1-10(8-12(16)17)4-6-14(18)7-5-11(15)9-13(14,2)3/h4-8,18H,9H2,1-3H3,(H,16,17)/b6-4+,10-8- |
| InChIKey | YAFCFUFXKNGXPE-VFAAGJRPSA-N |
| XLogP | 1.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|