C12H27N — CID 14598866
2,4,4,6,6-pentamethylheptan-2-amine (PubChem CID 14598866) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is 2,4,4,6,6-pentamethylheptan-2-amine.
| Compound Name | 2,4,4,6,6-pentamethylheptan-2-amine |
|---|---|
| PubChem CID | 14598866 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | 2,4,4,6,6-pentamethylheptan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C12H27N/c1-10(2,3)8-11(4,5)9-12(6,7)13/h8-9,13H2,1-7H3 |
| InChIKey | FREUGFSLPBDYHQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |