C30H35N7O2S2 — CID 145990035
4-[2-(1-methylpiperidin-4-yl)-4-(3-methylsulfonylphenyl)-1,3-thiazol-5-yl]-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 145990035) has the molecular formula C30H35N7O2S2 and a molecular weight of 589.80 g/mol. Its IUPAC name is 4-[2-(1-methylpiperidin-4-yl)-4-(3-methylsulfonylphenyl)-1,3-thiazol-5-yl]-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-[2-(1-methylpiperidin-4-yl)-4-(3-methylsulfonylphenyl)-1,3-thiazol-5-yl]-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 145990035 |
| Molecular Formula | C30H35N7O2S2 |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 4-[2-(1-methylpiperidin-4-yl)-4-(3-methylsulfonylphenyl)-1,3-thiazol-5-yl]-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | CN1CCC(CC1)C2=NC(=C(S2)C3=NC(=NC=C3)NC4=CC=C(C=C4)N5CCNCC5)C6=CC(=CC=C6)S(=O)(=O)C |
| InChI | InChI=1S/C30H35N7O2S2/c1-36-16-11-21(12-17-36)29-35-27(22-4-3-5-25(20-22)41(2,38)39)28(40-29)26-10-13-32-30(34-26)33-23-6-8-24(9-7-23)37-18-14-31-15-19-37/h3-10,13,20-21,31H,11-12,14-19H2,1-2H3,(H,32,33,34) |
| InChIKey | LNKUDEFEBSXIJW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | 930 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|