About 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea
1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea (PubChem CID 1459927) has the molecular formula C20H26ClN3O
and a molecular weight of 359.90 g/mol. Its IUPAC name is 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea |
| PubChem CID | 1459927 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea |
| SMILES | Cc1cc2cc(CN(C(=O)N(C)C)C3CCCC3)c(Cl)nc2cc1C |
| InChI | InChI=1S/C20H26ClN3O/c1-13-9-15-11-16(19(21)22-18(15)10-14(13)2)12-24(20(25)23(3)4)17-7-5-6-8-17/h9-11,17H,5-8,12H2,1-4H3 |
| InChIKey | MRRQTPQMVLIEEW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea?
The IUPAC name of 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea (CID 1459927) is 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea.
What is the SMILES notation for 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea?
The canonical SMILES for 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea is Cc1cc2cc(CN(C(=O)N(C)C)C3CCCC3)c(Cl)nc2cc1C.
What is the InChIKey of 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea?
The InChIKey is MRRQTPQMVLIEEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26ClN3O/c1-13-9-15-11-16(19(21)22-18(15)10-14(13)2)12-24(20(25)23(3)4)17-7-5-6-8-17/h9-11,17H,5-8,12H2,1-4H3.
What are the key properties of 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea?
1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea has a molecular weight of 359.90 g/mol, XLogP of 4.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-1-cyclopentyl-3,3-dimethylurea is sourced from PubChem (CID 1459927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).