C18H22N2O7S2 — CID 14599387
2,2-dimethylpropanoyloxymethyl (2S,5R,6E)-3,3-dimethyl-4,4,7-trioxo-6-(1,2-thiazol-3-ylmethylidene)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 14599387) has the molecular formula C18H22N2O7S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2S,5R,6E)-3,3-dimethyl-4,4,7-trioxo-6-(1,2-thiazol-3-ylmethylidene)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6E)-3,3-dimethyl-4,4,7-trioxo-6-(1,2-thiazol-3-ylmethylidene)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 14599387 |
| Molecular Formula | C18H22N2O7S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6E)-3,3-dimethyl-4,4,7-trioxo-6-(1,2-thiazol-3-ylmethylidene)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)[C@@H]1N2C(=O)/C(=C\c3ccsn3)[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C18H22N2O7S2/c1-17(2,3)16(23)27-9-26-15(22)12-18(4,5)29(24,25)14-11(13(21)20(12)14)8-10-6-7-28-19-10/h6-8,12,14H,9H2,1-5H3/b11-8+/t12-,14+/m0/s1 |
| InChIKey | STUBOGXPVNDXTI-RBDCFEFUSA-N |
| XLogP | 1.36 |
| TPSA | 119.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|