About US10285989, Example 132
US10285989, Example 132 (PubChem CID 145996204) has the molecular formula C18H23F3N4O3
and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-morpholin-4-yl-6-oxo-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]-1,3-diazinane-4-carboxamide.
Molecular Properties
| Compound Name | US10285989, Example 132 |
| PubChem CID | 145996204 |
| Molecular Formula | C18H23F3N4O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-morpholin-4-yl-6-oxo-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]-1,3-diazinane-4-carboxamide |
| SMILES | C[C@H](C1=CC=C(C=C1)C(F)(F)F)NC(=O)C2CC(=O)NC(N2)N3CCOCC3 |
| InChI | InChI=1S/C18H23F3N4O3/c1-11(12-2-4-13(5-3-12)18(19,20)21)22-16(27)14-10-15(26)24-17(23-14)25-6-8-28-9-7-25/h2-5,11,14,17,23H,6-10H2,1H3,(H,22,27)(H,24,26)/t11-,14?,17?/m1/s1 |
| InChIKey | POQPMWSHJKZLDH-ACCOQDJYSA-N |
| XLogP | 0.90 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | 561 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze US10285989, Example 132 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10285989, Example 132?
The IUPAC name of US10285989, Example 132 (CID 145996204) is 2-morpholin-4-yl-6-oxo-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]-1,3-diazinane-4-carboxamide.
What is the SMILES notation for US10285989, Example 132?
The canonical SMILES for US10285989, Example 132 is C[C@H](C1=CC=C(C=C1)C(F)(F)F)NC(=O)C2CC(=O)NC(N2)N3CCOCC3.
What is the InChIKey of US10285989, Example 132?
The InChIKey is POQPMWSHJKZLDH-ACCOQDJYSA-N. The full InChI is InChI=1S/C18H23F3N4O3/c1-11(12-2-4-13(5-3-12)18(19,20)21)22-16(27)14-10-15(26)24-17(23-14)25-6-8-28-9-7-25/h2-5,11,14,17,23H,6-10H2,1H3,(H,22,27)(H,24,26)/t11-,14?,17?/m1/s1.
What are the key properties of US10285989, Example 132?
US10285989, Example 132 has a molecular weight of 400.40 g/mol, XLogP of 0.90, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for US10285989, Example 132 is sourced from PubChem (CID 145996204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).