C25H18N6OS — CID 146000152
4-[(E)-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]thieno[3,2-d]pyrimidin-2-yl]hydrazinylidene]methyl]benzonitrile (PubChem CID 146000152) has the molecular formula C25H18N6OS and a molecular weight of 450.53 g/mol. Its IUPAC name is 4-[(E)-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]thieno[3,2-d]pyrimidin-2-yl]hydrazinylidene]methyl]benzonitrile.
| Compound Name | 4-[(E)-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]thieno[3,2-d]pyrimidin-2-yl]hydrazinylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 146000152 |
| Molecular Formula | C25H18N6OS |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 4-[(E)-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]thieno[3,2-d]pyrimidin-2-yl]hydrazinylidene]methyl]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1nc(N/N=C/c2ccc(C#N)cc2)nc2ccsc12 |
| InChI | InChI=1S/C25H18N6OS/c1-16-12-20(4-3-10-26)13-17(2)22(16)32-24-23-21(9-11-33-23)29-25(30-24)31-28-15-19-7-5-18(14-27)6-8-19/h3-9,11-13,15H,1-2H3,(H,29,30,31)/b4-3+,28-15+ |
| InChIKey | HANWHXLBGBLWIP-SUVKQGKFSA-N |
| XLogP | 5.95 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|