C29H38O5S — CID 14600023
[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methyl-2-phenylsulfanylpropanoate (PubChem CID 14600023) has the molecular formula C29H38O5S and a molecular weight of 498.69 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methyl-2-phenylsulfanylpropanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methyl-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 14600023 |
| Molecular Formula | C29H38O5S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methyl-2-phenylsulfanylpropanoate |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]2[C@@H](OC(=O)C(C)(C)Sc2ccccc2)C1 |
| InChI | InChI=1S/C29H38O5S/c1-18-14-20-11-10-19(2)24(13-12-22-16-21(30)17-26(31)33-22)27(20)25(15-18)34-28(32)29(3,4)35-23-8-6-5-7-9-23/h5-11,14,18-19,21-22,24-25,27,30H,12-13,15-17H2,1-4H3/t18-,19-,21+,22+,24-,25-,27-/m0/s1 |
| InChIKey | XCQKGXSEZLQNMT-NBYLKSIASA-N |
| XLogP | 5.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |