C17H12F3N3O4 — CID 146000355
2-[benzyl(methyl)amino]-8-nitro-6-(trifluoromethyl)-1,3-benzoxazin-4-one (PubChem CID 146000355) has the molecular formula C17H12F3N3O4 and a molecular weight of 379.29 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-8-nitro-6-(trifluoromethyl)-1,3-benzoxazin-4-one.
| Compound Name | 2-[benzyl(methyl)amino]-8-nitro-6-(trifluoromethyl)-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 146000355 |
| Molecular Formula | C17H12F3N3O4 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-[benzyl(methyl)amino]-8-nitro-6-(trifluoromethyl)-1,3-benzoxazin-4-one |
| SMILES | CN(Cc1ccccc1)c1nc(=O)c2cc(C(F)(F)F)cc([N+](=O)[O-])c2o1 |
| InChI | InChI=1S/C17H12F3N3O4/c1-22(9-10-5-3-2-4-6-10)16-21-15(24)12-7-11(17(18,19)20)8-13(23(25)26)14(12)27-16/h2-8H,9H2,1H3 |
| InChIKey | GRTVQZVGNDRESZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|