C23H24N6O3S2 — CID 146000381
N-[2-[(5-amino-2-pyridinyl)amino]ethyl]-4-[[2-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzenesulfonamide (PubChem CID 146000381) has the molecular formula C23H24N6O3S2 and a molecular weight of 496.62 g/mol. Its IUPAC name is N-[2-[(5-amino-2-pyridinyl)amino]ethyl]-4-[[2-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzenesulfonamide.
| Compound Name | N-[2-[(5-amino-2-pyridinyl)amino]ethyl]-4-[[2-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146000381 |
| Molecular Formula | C23H24N6O3S2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-[2-[(5-amino-2-pyridinyl)amino]ethyl]-4-[[2-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzenesulfonamide |
| SMILES | Nc1ccc(NCCNS(=O)(=O)c2ccc(COc3ccccc3-c3csc(N)n3)cc2)nc1 |
| InChI | InChI=1S/C23H24N6O3S2/c24-17-7-10-22(27-13-17)26-11-12-28-34(30,31)18-8-5-16(6-9-18)14-32-21-4-2-1-3-19(21)20-15-33-23(25)29-20/h1-10,13,15,28H,11-12,14,24H2,(H2,25,29)(H,26,27) |
| InChIKey | BNWCYSLYRBKDIU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|