C24H22FN5O3 — CID 146000461
N-[(E)-1-[2-(4-fluorophenyl)-2-methyl-5-pyridin-4-yl-1,3,4-oxadiazol-3-yl]ethylideneamino]-4-methoxybenzamide (PubChem CID 146000461) has the molecular formula C24H22FN5O3 and a molecular weight of 447.47 g/mol. Its IUPAC name is N-[(E)-1-[2-(4-fluorophenyl)-2-methyl-5-pyridin-4-yl-1,3,4-oxadiazol-3-yl]ethylideneamino]-4-methoxybenzamide.
| Compound Name | N-[(E)-1-[2-(4-fluorophenyl)-2-methyl-5-pyridin-4-yl-1,3,4-oxadiazol-3-yl]ethylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 146000461 |
| Molecular Formula | C24H22FN5O3 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[(E)-1-[2-(4-fluorophenyl)-2-methyl-5-pyridin-4-yl-1,3,4-oxadiazol-3-yl]ethylideneamino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C(\C)N2N=C(c3ccncc3)OC2(C)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H22FN5O3/c1-16(27-28-22(31)17-4-10-21(32-3)11-5-17)30-24(2,19-6-8-20(25)9-7-19)33-23(29-30)18-12-14-26-15-13-18/h4-15H,1-3H3,(H,28,31)/b27-16+ |
| InChIKey | DRHKWQRRNREPSC-JVWAILMASA-N |
| XLogP | 3.86 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|