C20H28O5 — CID 146000465
(E)-2-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]but-2-enedioic acid (PubChem CID 146000465) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (E)-2-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]but-2-enedioic acid.
| Compound Name | (E)-2-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 146000465 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (E)-2-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]ethyl]but-2-enedioic acid |
| SMILES | CC1=CC(=O)C[C@@H]2[C@@](C)(CC/C(=C\C(=O)O)C(=O)O)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C20H28O5/c1-12-5-7-20(4)13(2)9-15(21)11-16(20)19(12,3)8-6-14(18(24)25)10-17(22)23/h9-10,12,16H,5-8,11H2,1-4H3,(H,22,23)(H,24,25)/b14-10+/t12-,16-,19+,20+/m1/s1 |
| InChIKey | NUOABBLRCVSYGA-XWYWTPPXSA-N |
| XLogP | 3.84 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|