C24H19FN3O2+ — CID 146000638
3-fluoro-5-[[6-(2-methyl-1H-indazol-2-ium-6-yl)indol-1-yl]methyl]benzoic acid (PubChem CID 146000638) has the molecular formula C24H19FN3O2+ and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-fluoro-5-[[6-(2-methyl-1H-indazol-2-ium-6-yl)indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-fluoro-5-[[6-(2-methyl-1H-indazol-2-ium-6-yl)indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 146000638 |
| Molecular Formula | C24H19FN3O2+ |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-fluoro-5-[[6-(2-methyl-1H-indazol-2-ium-6-yl)indol-1-yl]methyl]benzoic acid |
| SMILES | C[n+]1cc2ccc(-c3ccc4ccn(Cc5cc(F)cc(C(=O)O)c5)c4c3)cc2[nH]1 |
| InChI | InChI=1S/C24H18FN3O2/c1-27-14-19-5-4-17(11-22(19)26-27)18-3-2-16-6-7-28(23(16)12-18)13-15-8-20(24(29)30)10-21(25)9-15/h2-12,14H,13H2,1H3,(H,29,30)/p+1 |
| InChIKey | KJOMSRRQHGNDDD-UHFFFAOYSA-O |
| XLogP | 4.50 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|