C23H28N6O2 — CID 146000668
2-N-[4-(morpholin-4-ylmethyl)phenyl]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 146000668) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 2-N-[4-(morpholin-4-ylmethyl)phenyl]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-(morpholin-4-ylmethyl)phenyl]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 146000668 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-N-[4-(morpholin-4-ylmethyl)phenyl]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)c(Oc2nc(N)nc(Nc3ccc(CN4CCOCC4)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C23H28N6O2/c1-15-12-16(2)20(17(3)13-15)31-23-27-21(24)26-22(28-23)25-19-6-4-18(5-7-19)14-29-8-10-30-11-9-29/h4-7,12-13H,8-11,14H2,1-3H3,(H3,24,25,26,27,28) |
| InChIKey | MKJZPAWAFOTFQE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |