C34H30N6O4S2 — CID 146000969
N-[2-[[4-[(2-amino-1,3-benzothiazol-4-yl)oxymethyl]benzoyl]amino]ethyl]-3-[[4-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzamide (PubChem CID 146000969) has the molecular formula C34H30N6O4S2 and a molecular weight of 650.79 g/mol. Its IUPAC name is N-[2-[[4-[(2-amino-1,3-benzothiazol-4-yl)oxymethyl]benzoyl]amino]ethyl]-3-[[4-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzamide.
| Compound Name | N-[2-[[4-[(2-amino-1,3-benzothiazol-4-yl)oxymethyl]benzoyl]amino]ethyl]-3-[[4-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzamide |
|---|---|
| PubChem CID | 146000969 |
| Molecular Formula | C34H30N6O4S2 |
| Molecular Weight | 650.79 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | N-[2-[[4-[(2-amino-1,3-benzothiazol-4-yl)oxymethyl]benzoyl]amino]ethyl]-3-[[4-(2-amino-1,3-thiazol-4-yl)phenoxy]methyl]benzamide |
| SMILES | Nc1nc(-c2ccc(OCc3cccc(C(=O)NCCNC(=O)c4ccc(COc5cccc6sc(N)nc56)cc4)c3)cc2)cs1 |
| InChI | InChI=1S/C34H30N6O4S2/c35-33-39-27(20-45-33)23-11-13-26(14-12-23)43-19-22-3-1-4-25(17-22)32(42)38-16-15-37-31(41)24-9-7-21(8-10-24)18-44-28-5-2-6-29-30(28)40-34(36)46-29/h1-14,17,20H,15-16,18-19H2,(H2,35,39)(H2,36,40)(H,37,41)(H,38,42) |
| InChIKey | PKEBIYBTUKKKQK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.79 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|