About 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate
1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate (PubChem CID 14600121) has the molecular formula C17H21NO5
and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate |
| PubChem CID | 14600121 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)OCc2ccccc2)CCC1=O |
| InChI | InChI=1S/C17H21NO5/c1-2-22-16(20)14-8-10-18(11-9-15(14)19)17(21)23-12-13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3 |
| InChIKey | YMPFJXQFTCDJOB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate?
The IUPAC name of 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate (CID 14600121) is 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate.
What is the SMILES notation for 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate?
The canonical SMILES for 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate is CCOC(=O)C1CCN(C(=O)OCc2ccccc2)CCC1=O.
What is the InChIKey of 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate?
The InChIKey is YMPFJXQFTCDJOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO5/c1-2-22-16(20)14-8-10-18(11-9-15(14)19)17(21)23-12-13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3.
What are the key properties of 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate?
1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate has a molecular weight of 319.36 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-benzyl 4-O-ethyl 5-oxoazepane-1,4-dicarboxylate is sourced from PubChem (CID 14600121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).