C19H30O5 — CID 146001241
(E)-5-[(1S,2R,3R,6R)-3-acetyl-2-(carboxymethyl)-1,3,6-trimethylcyclohexyl]-3-methylpent-2-enoic acid (PubChem CID 146001241) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (E)-5-[(1S,2R,3R,6R)-3-acetyl-2-(carboxymethyl)-1,3,6-trimethylcyclohexyl]-3-methylpent-2-enoic acid.
| Compound Name | (E)-5-[(1S,2R,3R,6R)-3-acetyl-2-(carboxymethyl)-1,3,6-trimethylcyclohexyl]-3-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 146001241 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (E)-5-[(1S,2R,3R,6R)-3-acetyl-2-(carboxymethyl)-1,3,6-trimethylcyclohexyl]-3-methylpent-2-enoic acid |
| SMILES | CC(=O)[C@]1(C)CC[C@@H](C)[C@](C)(CC/C(C)=C/C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C19H30O5/c1-12(10-16(21)22)6-8-18(4)13(2)7-9-19(5,14(3)20)15(18)11-17(23)24/h10,13,15H,6-9,11H2,1-5H3,(H,21,22)(H,23,24)/b12-10+/t13-,15-,18+,19+/m1/s1 |
| InChIKey | VNHYEHLTHMXTID-ZJSMRGKISA-N |
| XLogP | 3.92 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|