C21H30O4 — CID 146001242
(3aR,6R,7S,7aR)-7-[2-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]ethyl]-3,3a,6,7-tetramethyl-4,5,6,7a-tetrahydro-1H-indene-2-carbaldehyde (PubChem CID 146001242) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (3aR,6R,7S,7aR)-7-[2-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]ethyl]-3,3a,6,7-tetramethyl-4,5,6,7a-tetrahydro-1H-indene-2-carbaldehyde.
| Compound Name | (3aR,6R,7S,7aR)-7-[2-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]ethyl]-3,3a,6,7-tetramethyl-4,5,6,7a-tetrahydro-1H-indene-2-carbaldehyde |
|---|---|
| PubChem CID | 146001242 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (3aR,6R,7S,7aR)-7-[2-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]ethyl]-3,3a,6,7-tetramethyl-4,5,6,7a-tetrahydro-1H-indene-2-carbaldehyde |
| SMILES | CO[C@@H]1OC(=O)C=C1CC[C@@]1(C)[C@H](C)CC[C@@]2(C)C(C)=C(C=O)C[C@H]12 |
| InChI | InChI=1S/C21H30O4/c1-13-6-8-21(4)14(2)16(12-22)10-17(21)20(13,3)9-7-15-11-18(23)25-19(15)24-5/h11-13,17,19H,6-10H2,1-5H3/t13-,17-,19-,20+,21+/m1/s1 |
| InChIKey | HCRYUHHUNQNHBK-MRCDGREHSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|