C24H17N3O5 — CID 146001362
3-[2-(3-methoxyphenyl)-6-nitro-1H-indol-3-yl]-1H-quinoline-2,4-dione (PubChem CID 146001362) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is 3-[2-(3-methoxyphenyl)-6-nitro-1H-indol-3-yl]-1H-quinoline-2,4-dione.
| Compound Name | 3-[2-(3-methoxyphenyl)-6-nitro-1H-indol-3-yl]-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 146001362 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 3-[2-(3-methoxyphenyl)-6-nitro-1H-indol-3-yl]-1H-quinoline-2,4-dione |
| SMILES | COc1cccc(-c2[nH]c3cc([N+](=O)[O-])ccc3c2C2C(=O)Nc3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H17N3O5/c1-32-15-6-4-5-13(11-15)22-20(16-10-9-14(27(30)31)12-19(16)25-22)21-23(28)17-7-2-3-8-18(17)26-24(21)29/h2-12,21,25H,1H3,(H,26,29) |
| InChIKey | AKBNHUVAIBZBSG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|