About bromozinc(1+);hexylsulfanylbenzene
bromozinc(1+);hexylsulfanylbenzene (PubChem CID 146001940) has the molecular formula C12H17BrSZn
and a molecular weight of 338.63 g/mol. Its IUPAC name is bromozinc(1+);hexylsulfanylbenzene.
Molecular Properties
| Compound Name | bromozinc(1+);hexylsulfanylbenzene |
| PubChem CID | 146001940 |
| Molecular Formula | C12H17BrSZn |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | bromozinc(1+);hexylsulfanylbenzene |
| SMILES | CCCCCCSc1cc[c-]cc1.[Zn+]Br |
| InChI | InChI=1S/C12H17S.BrH.Zn/c1-2-3-4-8-11-13-12-9-6-5-7-10-12;;/h6-7,9-10H,2-4,8,11H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | FEZYJOYHWOHUOT-UHFFFAOYSA-M |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromozinc(1+);hexylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromozinc(1+);hexylsulfanylbenzene?
The IUPAC name of bromozinc(1+);hexylsulfanylbenzene (CID 146001940) is bromozinc(1+);hexylsulfanylbenzene.
What is the SMILES notation for bromozinc(1+);hexylsulfanylbenzene?
The canonical SMILES for bromozinc(1+);hexylsulfanylbenzene is CCCCCCSc1cc[c-]cc1.[Zn+]Br.
What is the InChIKey of bromozinc(1+);hexylsulfanylbenzene?
The InChIKey is FEZYJOYHWOHUOT-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H17S.BrH.Zn/c1-2-3-4-8-11-13-12-9-6-5-7-10-12;;/h6-7,9-10H,2-4,8,11H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of bromozinc(1+);hexylsulfanylbenzene?
bromozinc(1+);hexylsulfanylbenzene has a molecular weight of 338.63 g/mol, XLogP of 5.00, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromozinc(1+);hexylsulfanylbenzene is sourced from PubChem (CID 146001940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).