C16H21ClO — CID 146002976
1-(4-chloro-3-methylphenyl)-3,5-dimethylhept-1-yn-3-ol (PubChem CID 146002976) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-3,5-dimethylhept-1-yn-3-ol.
| Compound Name | 1-(4-chloro-3-methylphenyl)-3,5-dimethylhept-1-yn-3-ol |
|---|---|
| PubChem CID | 146002976 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-3,5-dimethylhept-1-yn-3-ol |
| SMILES | CCC(C)CC(C)(O)C#Cc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C16H21ClO/c1-5-12(2)11-16(4,18)9-8-14-6-7-15(17)13(3)10-14/h6-7,10,12,18H,5,11H2,1-4H3 |
| InChIKey | VCRVBZRNSVSZPL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|