C15H20 — CID 146003285
4-hept-1-ynyl-1,2-dimethylbenzene (PubChem CID 146003285) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 4-hept-1-ynyl-1,2-dimethylbenzene.
| Compound Name | 4-hept-1-ynyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 146003285 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 4-hept-1-ynyl-1,2-dimethylbenzene |
| SMILES | CCCCCC#Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H20/c1-4-5-6-7-8-9-15-11-10-13(2)14(3)12-15/h10-12H,4-7H2,1-3H3 |
| InChIKey | BKQGOZQADZVEFX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|