C15H6F10O — CID 146006980
2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-fluoronaphthalen-1-yl)pentan-1-one (PubChem CID 146006980) has the molecular formula C15H6F10O and a molecular weight of 392.19 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-fluoronaphthalen-1-yl)pentan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-fluoronaphthalen-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 146006980 |
| Molecular Formula | C15H6F10O |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-fluoronaphthalen-1-yl)pentan-1-one |
| SMILES | O=C(c1ccc(F)c2ccccc12)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H6F10O/c16-10-6-5-9(7-3-1-2-4-8(7)10)11(26)12(17,18)13(19,20)14(21,22)15(23,24)25/h1-6H |
| InChIKey | XRVVQGJLFYTGOB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|