C12H13BrF2O — CID 146008012
2-bromo-2,2-difluoro-1-(2,3,5,6-tetramethylphenyl)ethanone (PubChem CID 146008012) has the molecular formula C12H13BrF2O and a molecular weight of 291.14 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-1-(2,3,5,6-tetramethylphenyl)ethanone.
| Compound Name | 2-bromo-2,2-difluoro-1-(2,3,5,6-tetramethylphenyl)ethanone |
|---|---|
| PubChem CID | 146008012 |
| Molecular Formula | C12H13BrF2O |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-bromo-2,2-difluoro-1-(2,3,5,6-tetramethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C)c(C(=O)C(F)(F)Br)c1C |
| InChI | InChI=1S/C12H13BrF2O/c1-6-5-7(2)9(4)10(8(6)3)11(16)12(13,14)15/h5H,1-4H3 |
| InChIKey | BCBIFXLCGZQEHC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|