C12H11Cl2F3O — CID 146008490
3-chloro-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethylpropan-1-one (PubChem CID 146008490) has the molecular formula C12H11Cl2F3O and a molecular weight of 299.12 g/mol. Its IUPAC name is 3-chloro-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 146008490 |
| Molecular Formula | C12H11Cl2F3O |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 3-chloro-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CCl)C(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11Cl2F3O/c1-11(2,6-13)10(18)7-3-4-9(14)8(5-7)12(15,16)17/h3-5H,6H2,1-2H3 |
| InChIKey | MJZMDPXWZYBDIW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|