C9H2Cl3F5O — CID 146009662
2,2,3,3,3-pentafluoro-1-(2,3,5-trichlorophenyl)propan-1-one (PubChem CID 146009662) has the molecular formula C9H2Cl3F5O and a molecular weight of 327.46 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(2,3,5-trichlorophenyl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(2,3,5-trichlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 146009662 |
| Molecular Formula | C9H2Cl3F5O |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 325.91 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(2,3,5-trichlorophenyl)propan-1-one |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H2Cl3F5O/c10-3-1-4(6(12)5(11)2-3)7(18)8(13,14)9(15,16)17/h1-2H |
| InChIKey | HCQKCPLVKQOXKB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|