C10H10F2O3 — CID 146010216
1-(2,5-difluoro-4-methoxyphenyl)-2-methoxyethanone (PubChem CID 146010216) has the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-methoxyphenyl)-2-methoxyethanone.
| Compound Name | 1-(2,5-difluoro-4-methoxyphenyl)-2-methoxyethanone |
|---|---|
| PubChem CID | 146010216 |
| Molecular Formula | C10H10F2O3 |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-(2,5-difluoro-4-methoxyphenyl)-2-methoxyethanone |
| SMILES | COCC(=O)c1cc(F)c(OC)cc1F |
| InChI | InChI=1S/C10H10F2O3/c1-14-5-9(13)6-3-8(12)10(15-2)4-7(6)11/h3-4H,5H2,1-2H3 |
| InChIKey | YHCYCQGXRIYGKS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |