C13H18O3S — CID 146010380
ethyl 5-(3,3-dimethylbutanoyl)thiophene-2-carboxylate (PubChem CID 146010380) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is ethyl 5-(3,3-dimethylbutanoyl)thiophene-2-carboxylate.
| Compound Name | ethyl 5-(3,3-dimethylbutanoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 146010380 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | ethyl 5-(3,3-dimethylbutanoyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)CC(C)(C)C)s1 |
| InChI | InChI=1S/C13H18O3S/c1-5-16-12(15)11-7-6-10(17-11)9(14)8-13(2,3)4/h6-7H,5,8H2,1-4H3 |
| InChIKey | UHIZMNDMPVHMQZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |