C19H21ClFN3O2S3 — CID 14601140
cyclopentyl 2-[2-chloro-4-fluoro-5-[(3-sulfanylidene-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate (PubChem CID 14601140) has the molecular formula C19H21ClFN3O2S3 and a molecular weight of 474.05 g/mol. Its IUPAC name is cyclopentyl 2-[2-chloro-4-fluoro-5-[(3-sulfanylidene-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate.
| Compound Name | cyclopentyl 2-[2-chloro-4-fluoro-5-[(3-sulfanylidene-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 14601140 |
| Molecular Formula | C19H21ClFN3O2S3 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | cyclopentyl 2-[2-chloro-4-fluoro-5-[(3-sulfanylidene-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
| SMILES | O=C(CSc1cc(/N=c2\sc(=S)n3n2CCCC3)c(F)cc1Cl)OC1CCCC1 |
| InChI | InChI=1S/C19H21ClFN3O2S3/c20-13-9-14(21)15(22-18-23-7-3-4-8-24(23)19(27)29-18)10-16(13)28-11-17(25)26-12-5-1-2-6-12/h9-10,12H,1-8,11H2/b22-18- |
| InChIKey | ORGCBNOEQMXOTM-PYCFMQQDSA-N |
| XLogP | 5.48 |
| TPSA | 48.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|