About 4-methoxy-7-propyl-1,3-benzodioxole
4-methoxy-7-propyl-1,3-benzodioxole (PubChem CID 14601156) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-methoxy-7-propyl-1,3-benzodioxole.
Molecular Properties
| Compound Name | 4-methoxy-7-propyl-1,3-benzodioxole |
| PubChem CID | 14601156 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4-methoxy-7-propyl-1,3-benzodioxole |
| SMILES | CCCc1ccc(OC)c2c1OCO2 |
| InChI | InChI=1S/C11H14O3/c1-3-4-8-5-6-9(12-2)11-10(8)13-7-14-11/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | HRUCCQNONJBVKQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-7-propyl-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-7-propyl-1,3-benzodioxole?
The IUPAC name of 4-methoxy-7-propyl-1,3-benzodioxole (CID 14601156) is 4-methoxy-7-propyl-1,3-benzodioxole.
What is the SMILES notation for 4-methoxy-7-propyl-1,3-benzodioxole?
The canonical SMILES for 4-methoxy-7-propyl-1,3-benzodioxole is CCCc1ccc(OC)c2c1OCO2.
What is the InChIKey of 4-methoxy-7-propyl-1,3-benzodioxole?
The InChIKey is HRUCCQNONJBVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-3-4-8-5-6-9(12-2)11-10(8)13-7-14-11/h5-6H,3-4,7H2,1-2H3.
What are the key properties of 4-methoxy-7-propyl-1,3-benzodioxole?
4-methoxy-7-propyl-1,3-benzodioxole has a molecular weight of 194.23 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-7-propyl-1,3-benzodioxole is sourced from PubChem (CID 14601156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).