C26H28N6O3 — CID 146011590
3-[(3R)-3-[4-amino-7-oxo-3-(4-phenoxyphenyl)-4,5,6,7a-tetrahydro-3aH-pyrrolo[2,3-d]pyridazin-1-yl]piperidin-1-yl]-3-oxopropanenitrile (PubChem CID 146011590) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is 3-[(3R)-3-[4-amino-7-oxo-3-(4-phenoxyphenyl)-4,5,6,7a-tetrahydro-3aH-pyrrolo[2,3-d]pyridazin-1-yl]piperidin-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[(3R)-3-[4-amino-7-oxo-3-(4-phenoxyphenyl)-4,5,6,7a-tetrahydro-3aH-pyrrolo[2,3-d]pyridazin-1-yl]piperidin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 146011590 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 3-[(3R)-3-[4-amino-7-oxo-3-(4-phenoxyphenyl)-4,5,6,7a-tetrahydro-3aH-pyrrolo[2,3-d]pyridazin-1-yl]piperidin-1-yl]-3-oxopropanenitrile |
| SMILES | N#CCC(=O)N1CCC[C@@H](N2C=C(c3ccc(Oc4ccccc4)cc3)C3C(N)NNC(=O)C32)C1 |
| InChI | InChI=1S/C26H28N6O3/c27-13-12-22(33)31-14-4-5-18(15-31)32-16-21(23-24(32)26(34)30-29-25(23)28)17-8-10-20(11-9-17)35-19-6-2-1-3-7-19/h1-3,6-11,16,18,23-25,29H,4-5,12,14-15,28H2,(H,30,34)/t18-,23?,24?,25?/m1/s1 |
| InChIKey | ORCGEWCQSWGSHN-SUISJWRUSA-N |
| XLogP | 1.94 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |