C26H28ClN5O3 — CID 146011636
4-amino-3-[4-(2-chlorophenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-4,5,6,7a-tetrahydro-3aH-pyrrolo[2,3-d]pyridazin-7-one (PubChem CID 146011636) has the molecular formula C26H28ClN5O3 and a molecular weight of 494.00 g/mol. Its IUPAC name is 4-amino-3-[4-(2-chlorophenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-4,5,6,7a-tetrahydro-3aH-pyrrolo[2,3-d]pyridazin-7-one.
| Compound Name | 4-amino-3-[4-(2-chlorophenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-4,5,6,7a-tetrahydro-3aH-pyrrolo[2,3-d]pyridazin-7-one |
|---|---|
| PubChem CID | 146011636 |
| Molecular Formula | C26H28ClN5O3 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 4-amino-3-[4-(2-chlorophenoxy)phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-4,5,6,7a-tetrahydro-3aH-pyrrolo[2,3-d]pyridazin-7-one |
| SMILES | C=CC(=O)N1CCC[C@@H](N2C=C(c3ccc(Oc4ccccc4Cl)cc3)C3C(N)NNC(=O)C32)C1 |
| InChI | InChI=1S/C26H28ClN5O3/c1-2-22(33)31-13-5-6-17(14-31)32-15-19(23-24(32)26(34)30-29-25(23)28)16-9-11-18(12-10-16)35-21-8-4-3-7-20(21)27/h2-4,7-12,15,17,23-25,29H,1,5-6,13-14,28H2,(H,30,34)/t17-,23?,24?,25?/m1/s1 |
| InChIKey | VKNQVDKJCNVGJL-LQHVSJJTSA-N |
| XLogP | 2.87 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|