C26H28F4N6O4 — CID 146011743
tert-butyl (3R,4R)-4-(cyanomethyl)-3-fluoro-4-[4-oxo-3-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]imino-2,3a-dihydropyrazolo[4,3-c]pyridin-1-yl]piperidine-1-carboxylate (PubChem CID 146011743) has the molecular formula C26H28F4N6O4 and a molecular weight of 564.54 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-(cyanomethyl)-3-fluoro-4-[4-oxo-3-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]imino-2,3a-dihydropyrazolo[4,3-c]pyridin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-(cyanomethyl)-3-fluoro-4-[4-oxo-3-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]imino-2,3a-dihydropyrazolo[4,3-c]pyridin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146011743 |
| Molecular Formula | C26H28F4N6O4 |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | tert-butyl (3R,4R)-4-(cyanomethyl)-3-fluoro-4-[4-oxo-3-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]imino-2,3a-dihydropyrazolo[4,3-c]pyridin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@](CC#N)(N2N/C(=N\c3ccc([C@H](O)C(F)(F)F)cc3)C3C(=O)N=CC=C32)[C@H](F)C1 |
| InChI | InChI=1S/C26H28F4N6O4/c1-24(2,3)40-23(39)35-13-10-25(9-11-31,18(27)14-35)36-17-8-12-32-22(38)19(17)21(34-36)33-16-6-4-15(5-7-16)20(37)26(28,29)30/h4-8,12,18-20,37H,9-10,13-14H2,1-3H3,(H,33,34)/t18-,19?,20+,25+/m1/s1 |
| InChIKey | CNYORZPGJXLJRF-DLTUQCNGSA-N |
| XLogP | 3.87 |
| TPSA | 130.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|