C23H24FN3O — CID 146012388
3-(4-fluorophenyl)-1-pentyl-2-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one (PubChem CID 146012388) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-pentyl-2-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-(4-fluorophenyl)-1-pentyl-2-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 146012388 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-(4-fluorophenyl)-1-pentyl-2-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one |
| SMILES | CCCCCn1c2c(c(-c3ccc(F)cc3)c1-c1ccncc1)C(=O)NCC2 |
| InChI | InChI=1S/C23H24FN3O/c1-2-3-4-15-27-19-11-14-26-23(28)21(19)20(16-5-7-18(24)8-6-16)22(27)17-9-12-25-13-10-17/h5-10,12-13H,2-4,11,14-15H2,1H3,(H,26,28) |
| InChIKey | DTIDBPYPWYOOLG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|