About 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride
2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride (PubChem CID 146012688) has the molecular formula C7H11ClN2O
and a molecular weight of 174.63 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride |
| PubChem CID | 146012688 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride |
| SMILES | Cl.c1coc(C2CCCN2)n1 |
| InChI | InChI=1S/C7H10N2O.ClH/c1-2-6(8-3-1)7-9-4-5-10-7;/h4-6,8H,1-3H2;1H |
| InChIKey | ORTWNFIITLZSGF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride?
The IUPAC name of 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride (CID 146012688) is 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride.
What is the SMILES notation for 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride?
The canonical SMILES for 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride is Cl.c1coc(C2CCCN2)n1.
What is the InChIKey of 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride?
The InChIKey is ORTWNFIITLZSGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O.ClH/c1-2-6(8-3-1)7-9-4-5-10-7;/h4-6,8H,1-3H2;1H.
What are the key properties of 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride?
2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride has a molecular weight of 174.63 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-2-yl-1,3-oxazole;hydrochloride is sourced from PubChem (CID 146012688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).