About 2-chloro-3,5,6,7-tetramethylquinoline
2-chloro-3,5,6,7-tetramethylquinoline (PubChem CID 146013311) has the molecular formula C13H14ClN
and a molecular weight of 219.71 g/mol. Its IUPAC name is 2-chloro-3,5,6,7-tetramethylquinoline.
Molecular Properties
| Compound Name | 2-chloro-3,5,6,7-tetramethylquinoline |
| PubChem CID | 146013311 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-chloro-3,5,6,7-tetramethylquinoline |
| SMILES | Cc1cc2c(C)c(C)c(C)cc2nc1Cl |
| InChI | InChI=1S/C13H14ClN/c1-7-6-12-11(10(4)9(7)3)5-8(2)13(14)15-12/h5-6H,1-4H3 |
| InChIKey | VKRGQBKBKVVXRA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3,5,6,7-tetramethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,5,6,7-tetramethylquinoline?
The IUPAC name of 2-chloro-3,5,6,7-tetramethylquinoline (CID 146013311) is 2-chloro-3,5,6,7-tetramethylquinoline.
What is the SMILES notation for 2-chloro-3,5,6,7-tetramethylquinoline?
The canonical SMILES for 2-chloro-3,5,6,7-tetramethylquinoline is Cc1cc2c(C)c(C)c(C)cc2nc1Cl.
What is the InChIKey of 2-chloro-3,5,6,7-tetramethylquinoline?
The InChIKey is VKRGQBKBKVVXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN/c1-7-6-12-11(10(4)9(7)3)5-8(2)13(14)15-12/h5-6H,1-4H3.
What are the key properties of 2-chloro-3,5,6,7-tetramethylquinoline?
2-chloro-3,5,6,7-tetramethylquinoline has a molecular weight of 219.71 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,5,6,7-tetramethylquinoline is sourced from PubChem (CID 146013311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).