About 3,6-dichloropyrazine-2,5-dicarbonitrile
3,6-dichloropyrazine-2,5-dicarbonitrile (PubChem CID 146013391) has the molecular formula C6Cl2N4
and a molecular weight of 199.00 g/mol. Its IUPAC name is 3,6-dichloropyrazine-2,5-dicarbonitrile.
Molecular Properties
| Compound Name | 3,6-dichloropyrazine-2,5-dicarbonitrile |
| PubChem CID | 146013391 |
| Molecular Formula | C6Cl2N4 |
| Molecular Weight | 199.00 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | 3,6-dichloropyrazine-2,5-dicarbonitrile |
| SMILES | N#Cc1nc(Cl)c(C#N)nc1Cl |
| InChI | InChI=1S/C6Cl2N4/c7-5-3(1-9)11-6(8)4(2-10)12-5 |
| InChIKey | SILTXHLSAGGGLP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.00 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-dichloropyrazine-2,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloropyrazine-2,5-dicarbonitrile?
The IUPAC name of 3,6-dichloropyrazine-2,5-dicarbonitrile (CID 146013391) is 3,6-dichloropyrazine-2,5-dicarbonitrile.
What is the SMILES notation for 3,6-dichloropyrazine-2,5-dicarbonitrile?
The canonical SMILES for 3,6-dichloropyrazine-2,5-dicarbonitrile is N#Cc1nc(Cl)c(C#N)nc1Cl.
What is the InChIKey of 3,6-dichloropyrazine-2,5-dicarbonitrile?
The InChIKey is SILTXHLSAGGGLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6Cl2N4/c7-5-3(1-9)11-6(8)4(2-10)12-5.
What are the key properties of 3,6-dichloropyrazine-2,5-dicarbonitrile?
3,6-dichloropyrazine-2,5-dicarbonitrile has a molecular weight of 199.00 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloropyrazine-2,5-dicarbonitrile is sourced from PubChem (CID 146013391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).