C34H36BF4NO6 — CID 146013651
10-(3,5-dimethoxyphenyl)-1,3,6,8-tetramethoxy-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate (PubChem CID 146013651) has the molecular formula C34H36BF4NO6 and a molecular weight of 641.47 g/mol. Its IUPAC name is 10-(3,5-dimethoxyphenyl)-1,3,6,8-tetramethoxy-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate.
| Compound Name | 10-(3,5-dimethoxyphenyl)-1,3,6,8-tetramethoxy-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate |
|---|---|
| PubChem CID | 146013651 |
| Molecular Formula | C34H36BF4NO6 |
| Molecular Weight | 641.47 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | 10-(3,5-dimethoxyphenyl)-1,3,6,8-tetramethoxy-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate |
| SMILES | COc1cc(OC)cc(-[n+]2c3cc(OC)cc(OC)c3c(-c3c(C)cc(C)cc3C)c3c(OC)cc(OC)cc32)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C34H36NO6.BF4/c1-19-10-20(2)31(21(3)11-19)34-32-27(15-25(38-6)17-29(32)40-8)35(22-12-23(36-4)14-24(13-22)37-5)28-16-26(39-7)18-30(41-9)33(28)34;2-1(3,4)5/h10-18H,1-9H3;/q+1;-1 |
| InChIKey | DNLLZEBRIYLUOW-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 59.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.47 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|