C12H12F4O2 — CID 146013735
methyl 3,4,4,4-tetrafluoro-3-(2-methylphenyl)butanoate (PubChem CID 146013735) has the molecular formula C12H12F4O2 and a molecular weight of 264.22 g/mol. Its IUPAC name is methyl 3,4,4,4-tetrafluoro-3-(2-methylphenyl)butanoate.
| Compound Name | methyl 3,4,4,4-tetrafluoro-3-(2-methylphenyl)butanoate |
|---|---|
| PubChem CID | 146013735 |
| Molecular Formula | C12H12F4O2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | methyl 3,4,4,4-tetrafluoro-3-(2-methylphenyl)butanoate |
| SMILES | COC(=O)CC(F)(c1ccccc1C)C(F)(F)F |
| InChI | InChI=1S/C12H12F4O2/c1-8-5-3-4-6-9(8)11(13,12(14,15)16)7-10(17)18-2/h3-6H,7H2,1-2H3 |
| InChIKey | MCBLONKNXFHUQM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |