C6H11BrN2 — CID 146013756
1,2,3,4,5,6-hexahydropyrrolo[3,4-c]pyrrole;hydrobromide (PubChem CID 146013756) has the molecular formula C6H11BrN2 and a molecular weight of 191.07 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydropyrrolo[3,4-c]pyrrole;hydrobromide.
| Compound Name | 1,2,3,4,5,6-hexahydropyrrolo[3,4-c]pyrrole;hydrobromide |
|---|---|
| PubChem CID | 146013756 |
| Molecular Formula | C6H11BrN2 |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 1,2,3,4,5,6-hexahydropyrrolo[3,4-c]pyrrole;hydrobromide |
| SMILES | Br.C1NCC2=C1CNC2 |
| InChI | InChI=1S/C6H10N2.BrH/c1-5-2-8-4-6(5)3-7-1;/h7-8H,1-4H2;1H |
| InChIKey | NBVYWBXNJPNLJC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|