About methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate
methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate (PubChem CID 146014124) has the molecular formula C11H12FNO3
and a molecular weight of 225.22 g/mol. Its IUPAC name is methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate |
| PubChem CID | 146014124 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1F)OCCC2N |
| InChI | InChI=1S/C11H12FNO3/c1-15-11(14)7-3-2-6-8(13)4-5-16-10(6)9(7)12/h2-3,8H,4-5,13H2,1H3 |
| InChIKey | ZMTAIRURPXMRFD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate?
The IUPAC name of methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate (CID 146014124) is methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate.
What is the SMILES notation for methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate?
The canonical SMILES for methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate is COC(=O)c1ccc2c(c1F)OCCC2N.
What is the InChIKey of methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate?
The InChIKey is ZMTAIRURPXMRFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO3/c1-15-11(14)7-3-2-6-8(13)4-5-16-10(6)9(7)12/h2-3,8H,4-5,13H2,1H3.
What are the key properties of methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate?
methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate has a molecular weight of 225.22 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-8-fluoro-3,4-dihydro-2H-chromene-7-carboxylate is sourced from PubChem (CID 146014124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).