About (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide
(3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide (PubChem CID 146014408) has the molecular formula C9H11BrN4
and a molecular weight of 255.12 g/mol. Its IUPAC name is (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide.
Molecular Properties
| Compound Name | (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide |
| PubChem CID | 146014408 |
| Molecular Formula | C9H11BrN4 |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide |
| SMILES | Br.NCc1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C9H10N4.BrH/c10-6-8-11-9(13-12-8)7-4-2-1-3-5-7;/h1-5H,6,10H2,(H,11,12,13);1H |
| InChIKey | GXKMZHZZDBANKU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide?
The IUPAC name of (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide (CID 146014408) is (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide.
What is the SMILES notation for (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide?
The canonical SMILES for (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide is Br.NCc1nc(-c2ccccc2)n[nH]1.
What is the InChIKey of (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide?
The InChIKey is GXKMZHZZDBANKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4.BrH/c10-6-8-11-9(13-12-8)7-4-2-1-3-5-7;/h1-5H,6,10H2,(H,11,12,13);1H.
What are the key properties of (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide?
(3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide has a molecular weight of 255.12 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-1H-1,2,4-triazol-5-yl)methanamine;hydrobromide is sourced from PubChem (CID 146014408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).