About (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine
(3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine (PubChem CID 14601442) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine |
| PubChem CID | 14601442 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine |
| SMILES | NCC1CC(OCc2ccccc2)=NO1 |
| InChI | InChI=1S/C11H14N2O2/c12-7-10-6-11(13-15-10)14-8-9-4-2-1-3-5-9/h1-5,10H,6-8,12H2 |
| InChIKey | NVTKDPWDHZNADC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine?
The IUPAC name of (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine (CID 14601442) is (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine.
What is the SMILES notation for (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine?
The canonical SMILES for (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine is NCC1CC(OCc2ccccc2)=NO1.
What is the InChIKey of (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine?
The InChIKey is NVTKDPWDHZNADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c12-7-10-6-11(13-15-10)14-8-9-4-2-1-3-5-9/h1-5,10H,6-8,12H2.
What are the key properties of (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine?
(3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine has a molecular weight of 206.25 g/mol, XLogP of 1.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylmethoxy-4,5-dihydro-1,2-oxazol-5-yl)methanamine is sourced from PubChem (CID 14601442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).