C5H8FN3O2 — CID 146014533
(5S,6R)-5-fluoro-6-hydroxy-4-imino-1-methyl-1,3-diazinan-2-one (PubChem CID 146014533) has the molecular formula C5H8FN3O2 and a molecular weight of 161.14 g/mol. Its IUPAC name is (5S,6R)-5-fluoro-6-hydroxy-4-imino-1-methyl-1,3-diazinan-2-one.
| Compound Name | (5S,6R)-5-fluoro-6-hydroxy-4-imino-1-methyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 146014533 |
| Molecular Formula | C5H8FN3O2 |
| Molecular Weight | 161.14 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | (5S,6R)-5-fluoro-6-hydroxy-4-imino-1-methyl-1,3-diazinan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C)[C@H](O)[C@H]1F |
| InChI | InChI=1S/C5H8FN3O2/c1-9-4(10)2(6)3(7)8-5(9)11/h2,4,10H,1H3,(H2,7,8,11)/t2-,4+/m0/s1 |
| InChIKey | GFTUZOVINMHQDL-ZAFYKAAXSA-N |
| XLogP | -0.72 |
| TPSA | 76.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.14 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|