About (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine
(1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine (PubChem CID 146014698) has the molecular formula C11H13N5O
and a molecular weight of 231.26 g/mol. Its IUPAC name is (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine.
Molecular Properties
| Compound Name | (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine |
| PubChem CID | 146014698 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine |
| SMILES | [H]/N=C(N)/N=C1\NC(=O)CCN1c1ccccc1 |
| InChI | InChI=1S/C11H13N5O/c12-10(13)15-11-14-9(17)6-7-16(11)8-4-2-1-3-5-8/h1-5H,6-7H2,(H4,12,13,14,15,17) |
| InChIKey | XZBAFUNMCLNJAM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine?
The IUPAC name of (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine (CID 146014698) is (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine.
What is the SMILES notation for (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine?
The canonical SMILES for (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine is [H]/N=C(N)/N=C1\NC(=O)CCN1c1ccccc1.
What is the InChIKey of (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine?
The InChIKey is XZBAFUNMCLNJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O/c12-10(13)15-11-14-9(17)6-7-16(11)8-4-2-1-3-5-8/h1-5H,6-7H2,(H4,12,13,14,15,17).
What are the key properties of (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine?
(1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine has a molecular weight of 231.26 g/mol, XLogP of 0.26, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(4-oxo-1-phenyl-1,3-diazinan-2-ylidene)guanidine is sourced from PubChem (CID 146014698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).