C20H33O4- — CID 146014762
(8Z,11Z,13E)-15-hydroperoxyicosa-8,11,13-trienoate (PubChem CID 146014762) has the molecular formula C20H33O4- and a molecular weight of 337.48 g/mol. Its IUPAC name is (8Z,11Z,13E)-15-hydroperoxyicosa-8,11,13-trienoate.
| Compound Name | (8Z,11Z,13E)-15-hydroperoxyicosa-8,11,13-trienoate |
|---|---|
| PubChem CID | 146014762 |
| Molecular Formula | C20H33O4- |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (8Z,11Z,13E)-15-hydroperoxyicosa-8,11,13-trienoate |
| SMILES | CCCCCC(/C=C/C=C\C/C=C\CCCCCCC(=O)[O-])OO |
| InChI | InChI=1S/C20H34O4/c1-2-3-13-16-19(24-23)17-14-11-9-7-5-4-6-8-10-12-15-18-20(21)22/h4-5,9,11,14,17,19,23H,2-3,6-8,10,12-13,15-16,18H2,1H3,(H,21,22)/p-1/b5-4-,11-9-,17-14+ |
| InChIKey | IUXBNSNRPLXHER-RHDCIPCHSA-M |
| XLogP | 4.57 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|