C18H18BF4N3O — CID 146014833
(5S)-5-benzyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium;trifluoroborane;fluoride (PubChem CID 146014833) has the molecular formula C18H18BF4N3O and a molecular weight of 379.17 g/mol. Its IUPAC name is (5S)-5-benzyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium;trifluoroborane;fluoride.
| Compound Name | (5S)-5-benzyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium;trifluoroborane;fluoride |
|---|---|
| PubChem CID | 146014833 |
| Molecular Formula | C18H18BF4N3O |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (5S)-5-benzyl-2-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium;trifluoroborane;fluoride |
| SMILES | FB(F)F.[F-].c1ccc(C[C@H]2COCc3nn(-c4ccccc4)c[n+]32)cc1 |
| InChI | InChI=1S/C18H18N3O.BF3.FH/c1-3-7-15(8-4-1)11-17-12-22-13-18-19-21(14-20(17)18)16-9-5-2-6-10-16;2-1(3)4;/h1-10,14,17H,11-13H2;;1H/q+1;;/p-1/t17-;;/m0../s1 |
| InChIKey | FGPCZOZPSRFEGN-RMRYJAPISA-M |
| XLogP | 0.36 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|