C15H29N4O9P — CID 146014961
(2S)-2-[[(2S)-5-amino-2-[[(2S,3R)-2-amino-3-phosphonooxybutanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid (PubChem CID 146014961) has the molecular formula C15H29N4O9P and a molecular weight of 440.39 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-amino-2-[[(2S,3R)-2-amino-3-phosphonooxybutanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-amino-2-[[(2S,3R)-2-amino-3-phosphonooxybutanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 146014961 |
| Molecular Formula | C15H29N4O9P |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (2S)-2-[[(2S)-5-amino-2-[[(2S,3R)-2-amino-3-phosphonooxybutanoyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)[C@@H](C)OP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C15H29N4O9P/c1-7(2)6-10(15(23)24)19-13(21)9(4-5-11(16)20)18-14(22)12(17)8(3)28-29(25,26)27/h7-10,12H,4-6,17H2,1-3H3,(H2,16,20)(H,18,22)(H,19,21)(H,23,24)(H2,25,26,27)/t8-,9+,10+,12+/m1/s1 |
| InChIKey | IYBBMZQQZGXVAU-WDCWCFNPSA-N |
| XLogP | -1.82 |
| TPSA | 231.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|